| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | N-(tert-Butoxycarbonyl)glycine-2-13C Basic information |
| Product Name: | N-(tert-Butoxycarbonyl)glycine-2-13C | | Synonyms: | N-(TERT-BUTOXYCARBONYL)GLYCINE-2-13C, 99 ATOM % 13C;boc-gly-oh-2-13c;N-(tert-Butoxycarbonyl)glycine-2-13C, Glycine-2-13C, N-t-Boc derivative;Glycine-2-13C, N-t-Boc derivative;N-Boc-glycine-13C;"Glycine-13C, N-Boc";Boc-Gly-OH-2-13C;Glycine-??-??-Boc (2-13C, 99%) | | CAS: | 145143-02-8 | | MF: | C7H13NO4 | | MW: | 176.18 | | EINECS: | | | Product Categories: | | | Mol File: | 145143-02-8.mol |  |
| | N-(tert-Butoxycarbonyl)glycine-2-13C Chemical Properties |
| Melting point | 86-89 °C(lit.) | | density | 1.160±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | Major Application | peptide synthesis | | InChI | 1S/C7H13NO4/c1-7(2,3)12-6(11)8-4-5(9)10/h4H2,1-3H3,(H,8,11)(H,9,10)/i4+1 | | InChIKey | VRPJIFMKZZEXLR-AZXPZELESA-N | | SMILES | CC(C)(C)OC(=O)N[13CH2]C(O)=O | | CAS Number Unlabeled | 4530-20-5 |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-36/37/39 | | RIDADR | UN2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | Storage Class | 11 - Combustible Solids |
| | N-(tert-Butoxycarbonyl)glycine-2-13C Usage And Synthesis |
| Uses | Isotope labelled N-Boc-glycine used in the composition of drugs containing Ketoprofen, and Sodium hyaluronate as antiinflammatory agents. |
| | N-(tert-Butoxycarbonyl)glycine-2-13C Preparation Products And Raw materials |
|