| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N-(tert-Butoxycarbonyl)glycine-1-13C Basic information |
| Product Name: | N-(tert-Butoxycarbonyl)glycine-1-13C | | Synonyms: | N-(TERT-BUTOXYCARBONYL)GLYCINE-1-13C, 99 ATOM % 13C;boc-gly-oh-1-13c;N-(tert-Butoxycarbonyl)glycine-1-13C, Glycine-1-13C, N-t-Boc derivative;Glycine-1-13C, N-t-Boc derivative;2-((tert-butoxycarbonyl)amino)-(1-13C)acetic acid;Boc-Gly-OH-1-13C;N-(tert-Butoxycarbonyl)glycine-1-13C | | CAS: | 97352-64-2 | | MF: | C7H13NO4 | | MW: | 176.19 | | EINECS: | | | Product Categories: | | | Mol File: | 97352-64-2.mol |  |
| | N-(tert-Butoxycarbonyl)glycine-1-13C Chemical Properties |
| Melting point | 86-89 °C (lit.) | | form | solid | | Major Application | peptide synthesis | | InChI | 1S/C7H13NO4/c1-7(2,3)12-6(11)8-4-5(9)10/h4H2,1-3H3,(H,8,11)(H,9,10)/i5+1 | | InChIKey | VRPJIFMKZZEXLR-HOSYLAQJSA-N | | SMILES | CC(C)(C)OC(=O)NC[13C](O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | 6.1 | | Storage Class | 11 - Combustible Solids |
| | N-(tert-Butoxycarbonyl)glycine-1-13C Usage And Synthesis |
| | N-(tert-Butoxycarbonyl)glycine-1-13C Preparation Products And Raw materials |
|