|
|
| | 2,2'-bipyridine-4-carboxylic acid Basic information |
| | 2,2'-bipyridine-4-carboxylic acid Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C11H8N2O2/c14-11(15)8-4-6-13-10(7-8)9-3-1-2-5-12-9/h1-7H,(H,14,15) | | InChIKey | FRYSEKUUHUUJPX-UHFFFAOYSA-N | | SMILES | C1(C2=NC=CC=C2)=NC=CC(C(O)=O)=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | RIDADR | 2811 | | WGK Germany | WGK 3 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2,2'-bipyridine-4-carboxylic acid Usage And Synthesis |
| Uses | 2,2'-Bipyridine-4-carboxylic acid is used as a ligand in the synthesis of MOF materials. |
| | 2,2'-bipyridine-4-carboxylic acid Preparation Products And Raw materials |
|