|
|
| | 5-CHLORO-2-NITRODIPHENYLAMINE Basic information |
| | 5-CHLORO-2-NITRODIPHENYLAMINE Chemical Properties |
| Melting point | 110-114 °C | | Boiling point | 370.4±32.0 °C(Predicted) | | density | 1.3696 (rough estimate) | | refractive index | 1.5270 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Very Slightly, Heated) | | form | Solid | | pka | -4.38±0.50(Predicted) | | color | Orange to Red | | InChI | InChI=1S/C12H9ClN2O2/c13-9-6-7-12(15(16)17)11(8-9)14-10-4-2-1-3-5-10/h1-8,14H | | InChIKey | FPKHZBVGKMTUHB-UHFFFAOYSA-N | | SMILES | C1(NC2=CC=CC=C2)=CC(Cl)=CC=C1[N+]([O-])=O | | CAS DataBase Reference | 25781-92-4(CAS DataBase Reference) |
| | 5-CHLORO-2-NITRODIPHENYLAMINE Usage And Synthesis |
| Chemical Properties | orange-red fine crystalline powder | | Uses | 5-Chloro-2-nitrodiphenylaMine can be used in the preparation of substituted Phenylbenzimidazoles. | | Uses | Reagent used in the preparation of substituted Phenylbenzimidazoles. |
| | 5-CHLORO-2-NITRODIPHENYLAMINE Preparation Products And Raw materials |
|