| Company Name: |
xinguokeji Gold |
| Tel: |
13120711461 |
| Email: |
363372932@qq.com |
| Company Name: |
Xihu CO.LTD Gold |
| Tel: |
0519-15261475005 15261475005 |
| Email: |
249584640@qq.com |
|
| | Fmoc-Phe-Thr(PSI-Me,me pro)-OH Basic information |
| Product Name: | Fmoc-Phe-Thr(PSI-Me,me pro)-OH | | Synonyms: | Fmoc-L-Phe-L-Thr[PSI(Me,Me)Pro]-OH;Reaxys ID: 19854654;Fmoc-L-Phe-L-Thr[PSI(Me,Me)Pro;(4S,5R)-3-[(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-phenylpropanoyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid;FMOC-PHE-THR(ΨME,ME PRO)-OH_1196703-48-6;(4S,5R)-3-[N-(9-Fluorenylmethyloxycarbonyl)-L-phenylalaninyl]-2,2,5-trimethyloxazolidine-4-carboxylic acid;Fmoc-Phe-Thr[Psi(Me,Me)Pro]-OH≥ 99% (HPLC);Fmoc-Phe-Thr[Ψ(Me,Me)Pro]-OH | | CAS: | 1196703-48-6 | | MF: | C31H32N2O6 | | MW: | 528.6 | | EINECS: | | | Product Categories: | peptide | | Mol File: | 1196703-48-6.mol |  |
| | Fmoc-Phe-Thr(PSI-Me,me pro)-OH Chemical Properties |
| Boiling point | 764.4±60.0 °C(Predicted) | | density | 1.258±0.06 g/cm3(Predicted) | | storage temp. | Store at +2°C to +8°C. | | pka | 3.14±0.60(Predicted) | | form | powder | | Major Application | peptide synthesis | | InChIKey | FFOYZGOZWLCJDO-VHEIIQRDSA-N | | SMILES | O1[C@H](C)[C@@H](C(O)=O)N(C(=O)[C@@H](NC(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)CC2=CC=CC=C2)C1(C)C |
| WGK Germany | WGK 2 | | HS Code | 2934999093 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Phe-Thr(PSI-Me,me pro)-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Fmoc-Phe-Thr(psime,MePro)-OH is used as a reactant in the synthesis of GUB06-046, a novel secretin/glucagon-like peptide 1 co-agonist. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Phe-Thr(PSI-Me,me pro)-OH Preparation Products And Raw materials |
|