| Company Name: |
Xihu CO.LTD Gold |
| Tel: |
0519-15261475005 15261475005 |
| Email: |
249584640@qq.com |
|
| | Fmoc-Tyr(tBu)-Ser(Psi(Me,Me)pro)-OH Basic information |
| Product Name: | Fmoc-Tyr(tBu)-Ser(Psi(Me,Me)pro)-OH | | Synonyms: | FMOC-TYR(TBU)-SER(PSI-ME,MEPRO)-OH;(4S)-3-(FMOC-TYR(TBU))-2,2-DIMETHYL-OXAZOLIDINE-4-CARBOXYLIC ACID;Fmoc-L-Tyr(tBu)-L-Ser[PSI(Me,Me)Pro]-OH;(4S)-3-[(2S)-3-[4-(1,1-Dimethylethoxy)phenyl]-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-1-oxopropyl]-2,2-dimethyl-4-oxazolidinecarboxylic acid;(S)-3-[Nα-(9-Fluorenylmethyloxycarbonyl)-O-tert-butyl-L-tyrosinyl]-2,2-dimethyloxazolidine-4-carboxylic acid;Fmoc-Tyr(tBu)-Ser[Psi(Me,Me)Pro]-OH≥ 99% (HPLC);Fmoc-Tyr(tBu)-Ser[Ψ(Me,Me)Pro]-OH;(9H-Fluoren-9-yl)MethOxy]Carbonyl Tyr(tBu)-SerPsi(Me, Me)Pro-OH | | CAS: | 878797-09-2 | | MF: | C34H38N2O7 | | MW: | 586.68 | | EINECS: | | | Product Categories: | peptide | | Mol File: | 878797-09-2.mol |  |
| | Fmoc-Tyr(tBu)-Ser(Psi(Me,Me)pro)-OH Chemical Properties |
| Boiling point | 795.6±60.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | storage temp. | Store at +2°C to +8°C. | | form | powder | | pka | 3.09±0.40(Predicted) | | Major Application | peptide synthesis | | InChIKey | DNJYPUYQFPFOKS-VMPREFPWSA-N | | SMILES | O1C[C@@H](C(O)=O)N(C(=O)[C@@H](NC(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)CC2=CC=C(OC(C)(C)C)C=C2)C1(C)C |
| WGK Germany | WGK 2 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Tyr(tBu)-Ser(Psi(Me,Me)pro)-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Fmoc-Tyr(tBu)-Ser(Psi(Me,Me)pro)-OH is mainly used in peptide synthesis. It consists of a dipeptide in which the serine residue has been reversibly protected as a structure-damaging proline-like TFA-labile oxazolidine. The reason for introducing the pseudoproline residue as a dipeptide is that it avoids the acylation of the hindered oxazolidine nitrogen. This has the added advantage of extending the peptide chain by two residues in a single step. The serine residue is regenerated in the normal trans fatty acid mediated cleavage reaction. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Tyr(tBu)-Ser(Psi(Me,Me)pro)-OH Preparation Products And Raw materials |
|