2-(Chloromethyl)quinoline hydrochloride manufacturers
|
| | 2-(Chloromethyl)quinoline hydrochloride Basic information |
| | 2-(Chloromethyl)quinoline hydrochloride Chemical Properties |
| Melting point | 183-187 °C(lit.) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Water Solubility | Soluble in water | | form | Powder | | color | Pale yellow to cream or light pink | | BRN | 3565832 | | InChI | InChI=1S/C10H8ClN.ClH/c11-7-9-6-5-8-3-1-2-4-10(8)12-9;/h1-6H,7H2;1H | | InChIKey | WDETYCRYUBGKCE-UHFFFAOYSA-N | | SMILES | C12C=CC=CC1=CC=C(CCl)N=2.Cl | | CAS DataBase Reference | 3747-74-8(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-38-41-43-36/37/38 | | Safety Statements | 26-36/37/39-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29334900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |
| | 2-(Chloromethyl)quinoline hydrochloride Usage And Synthesis |
| Chemical Properties | PALE YELLOW TO CREAM OR LIGHT PINK POWDER | | Uses | 2-(Chloromethyl)quinoline Hydrochloride, is a substituted Quinoline building block for the synthesis of various pharmaceutical and biologically active compounds. It can also be used for the preparation of Quinoline-based fluorescent zinc sensors, used as fluorescent probes. |
| | 2-(Chloromethyl)quinoline hydrochloride Preparation Products And Raw materials |
|