| Company Name: |
Ningxia Hao Rui Kang Technology Co. Ltd. Gold
|
| Tel: |
+86-13693538274; 13693538274 |
| Email: |
wangzhenguo@orealchem.com |
| Products Intro: |
Product Name:5-(4-Bromo-2-fluorophenyl)-1,3,4-thiadiazol-2-amine CAS:299937-74-9 Purity:96% Package:5g;1g;10g;50g Remarks:HRC-59
|
|
| | 5-(4-bromo-2-fluorophenyl)-1,3,4-thiadiazol-2-amine Basic information |
| | 5-(4-bromo-2-fluorophenyl)-1,3,4-thiadiazol-2-amine Chemical Properties |
| Boiling point | 396.8±52.0 °C(Predicted) | | density | 1.787±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 1.49±0.10(Predicted) | | InChI | InChI=1S/C8H5BrFN3S/c9-4-1-2-5(6(10)3-4)7-12-13-8(11)14-7/h1-3H,(H2,11,13) | | InChIKey | CSJYTTRMHZPUTO-UHFFFAOYSA-N | | SMILES | S1C(C2=CC=C(Br)C=C2F)=NN=C1N |
| | 5-(4-bromo-2-fluorophenyl)-1,3,4-thiadiazol-2-amine Usage And Synthesis |
| | 5-(4-bromo-2-fluorophenyl)-1,3,4-thiadiazol-2-amine Preparation Products And Raw materials |
|