|
|
| | Tetrapropyl ammonium chloride Basic information |
| Product Name: | Tetrapropyl ammonium chloride | | Synonyms: | TETRAPROPYLAMMONIUMCHLORIDE,94%;Tetra-n-propylammoniumchloride,98%;1-PROPANAMINIUM,N,N,N-TRIPROPYL-,CHLORIDE;Tetra-n-propylammonium chloride, 99+%;Tetrapropylazanium chloride;Tetrapropylaminium·chloride;5-[(2-methoxy-1-naphthalenyl)methylidene]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione;TETRAPROPYLAMMONIUM CHLORIDE, 98%TETRAPROPYLAMMONIUM CHLORIDE, 98%TETRAPROPYLAMMONIUM CHLORIDE, 98%TETRAPROPYLAMMONIUM CHLORIDE, 98% | | CAS: | 5810-42-4 | | MF: | C12H28ClN | | MW: | 221.81 | | EINECS: | 227-375-5 | | Product Categories: | Ammonium Chlorides (Quaternary);Quaternary Ammonium Compounds;Ammonium Salts;Greener Alternatives: Catalysis;Phase Transfer Catalysts;quarternary ammonium salts;Quaternary ammonium salt;TOP | | Mol File: | 5810-42-4.mol |  |
| | Tetrapropyl ammonium chloride Chemical Properties |
| Melting point | 240-242 °C (lit.) | | Boiling point | 358.03°C (rough estimate) | | density | 0.9461 (rough estimate) | | refractive index | 1.5868 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystals | | color | White | | Water Solubility | Soluble in water, acetone | | Sensitive | Hygroscopic | | BRN | 3567732 | | Stability: | Stable. Incompatible with strong oxidizing agents. Protect from moisture. | | InChI | InChI=1S/C12H28N.ClH/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1 | | InChIKey | FBEVECUEMUUFKM-UHFFFAOYSA-M | | SMILES | [N+](CCC)(CCC)(CCC)CCC.[Cl-] | | CAS DataBase Reference | 5810-42-4(CAS DataBase Reference) | | EPA Substance Registry System | Tetrapropylammonium chloride (5810-42-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | F | 3 | | TSCA | TSCA listed | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tetrapropyl ammonium chloride Usage And Synthesis |
| Chemical Properties | solid | | Uses | Tetra-n-propylammonium chloride is used as phase-transfer type applications. |
| | Tetrapropyl ammonium chloride Preparation Products And Raw materials |
|