| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Diethyl ethylidenemalonate Basic information |
| Product Name: | Diethyl ethylidenemalonate | | Synonyms: | Propanedioic acid, ethylidene-, diethyl ester;Diethyl 2-ethylidenepropane-1,3-dioate;1-Propene-1,1-dicarboxylic acid diethyl ester;Diethyl 1-propene-1,1-dicarboxylate;2-ethylidenemalonic acid diethyl ester;diethyl 2-ethylidenepropanedioate;Diethyl ethylideneMalonate 99%;nonanoic acid [3-(1-oxononoxy)-2,2-bis(1-oxononoxymethyl)propyl] ester | | CAS: | 1462-12-0 | | MF: | C9H14O4 | | MW: | 186.21 | | EINECS: | 215-965-5 | | Product Categories: | C8 to C9;Carbonyl Compounds;Esters | | Mol File: | 1462-12-0.mol |  |
| | Diethyl ethylidenemalonate Chemical Properties |
| Boiling point | 115-118 °C/17 mmHg (lit.) | | density | 1.019 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.442(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Clear, colourless | | Specific Gravity | 1.019 | | BRN | 1773932 | | InChI | InChI=1S/C9H14O4/c1-4-7(8(10)12-5-2)9(11)13-6-3/h4H,5-6H2,1-3H3 | | InChIKey | LBBAWVLUOZVYCC-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)/C(=C/C)/C(OCC)=O | | CAS DataBase Reference | 1462-12-0(CAS DataBase Reference) | | EPA Substance Registry System | Propanedioic acid, ethylidene-, diethyl ester (1462-12-0) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2917198090 | | Storage Class | 10 - Combustible liquids |
| | Diethyl ethylidenemalonate Usage And Synthesis |
| Uses | Diethyl Ethylidenemalonate is a useful intermediate for 1,4-addition and [3+2] cycloaddition reactions and in 2,4-dienoates synthesis. | | Preparation | Diethyl ethylidenemalonate is obtained by heating paraldehyde, Acetic Anhydride, and Diethyl Malonate. | | storage | Store at 5 °C. Use in a fume hood. |
| | Diethyl ethylidenemalonate Preparation Products And Raw materials |
|