|
|
| | Diethyl isopropylmalonate Basic information |
| | Diethyl isopropylmalonate Chemical Properties |
| Boiling point | 62 °C/0.35 mmHg (lit.) | | density | 0.981 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.42(lit.) | | Fp | 198 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 13.43±0.46(Predicted) | | color | Colourless | | BRN | 1101711 | | InChI | InChI=1S/C10H18O4/c1-5-13-9(11)8(7(3)4)10(12)14-6-2/h7-8H,5-6H2,1-4H3 | | InChIKey | BYQFBFWERHXONI-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(C(C)C)C(OCC)=O | | CAS DataBase Reference | 759-36-4(CAS DataBase Reference) |
| Safety Statements | 24/25 | | RIDADR | NA1993 | | WGK Germany | 1 | | HazardClass | IRRITANT | | HS Code | 29171900 |
| | Diethyl isopropylmalonate Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Diethyl Isopropylmalonate can be used to treat CCR2-mediated disease. | | General Description | Diethyl isopropylmalonate reacts with chalcone by Michael addition, under high pressure and fluoride catalyst, to form compounds having quarternary C atoms. |
| | Diethyl isopropylmalonate Preparation Products And Raw materials |
|