| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,4-Dichloro-6-methylphenol Basic information |
| Product Name: | 2,4-Dichloro-6-methylphenol | | Synonyms: | 4,6-Dichloro-2-methylphenol;dichlorocresol;o-Cresol, 4,6-dichloro-;Phenol, 2,4-dichloro-6-methyl-;4,6-DICHLORO-O-CRESOL;4,6-Dichloro-o-cresol, 3,5-Dichloro-2-hydroxytoluene;4,6-Dichloro-o-cresol;2,4-Dichloro-6-methylphenol 10 μg/mL in Methanol | | CAS: | 1570-65-6 | | MF: | C7H6Cl2O | | MW: | 177.03 | | EINECS: | 216-382-9 | | Product Categories: | | | Mol File: | 1570-65-6.mol |  |
| | 2,4-Dichloro-6-methylphenol Chemical Properties |
| Melting point | 53°C | | Boiling point | 225 °C | | density | 1.2970 (rough estimate) | | refractive index | 1.5625 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 8.41±0.23(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C7H6Cl2O/c1-4-2-5(8)3-6(9)7(4)10/h2-3,10H,1H3 | | InChIKey | WJQZZLQMLJPKQH-UHFFFAOYSA-N | | SMILES | C1(O)=C(C)C=C(Cl)C=C1Cl | | CAS DataBase Reference | 1570-65-6(CAS DataBase Reference) | | EPA Substance Registry System | 4,6-Dichloro-o-cresol (1570-65-6) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | HS Code | 2908190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 2,4-Dichloro-6-methylphenol Usage And Synthesis |
| Purification Methods | Crystallise the cresol from Et2O (m 55o) or water; it has m 53-54o after sublimation. [Beilstein 6 H 359, 6 II 332, 6 III 1267, 6 IV 2001.] |
| | 2,4-Dichloro-6-methylphenol Preparation Products And Raw materials |
|