| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:2-Benzofuranylboronic Acid Mida Ester CAS:1104637-65-1 Purity:99%+ Package:250mg;1g;5g;25g;100g
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:2-Benzofuranylboronic acid MIDA ester CAS:1104637-65-1 Purity:98% Remarks:MR01040072
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2-Benzofuranylboronic acid MIDA ester CAS:1104637-65-1 Purity:97% Package:1G Remarks:701106-1G
|
| Company Name: |
Rhawn Reagent
|
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
| Products Intro: |
Product Name:2-(Benzofuran-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 2-Benzofuranboronic acid MIDA ester CAS:1104637-65-1
|
| Company Name: |
Changzhou Kechem Bio-Scientific Co., LTD.
|
| Tel: |
0519-68985668 13685222090 |
| Email: |
sales@kechem.cn |
| Products Intro: |
Product Name:2-Benzofuranylboronic acid mida ester CAS:1104637-65-1 Purity:0.97 Package:g;kg
|
|
| | 2-(Benzofuran-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 2-Benzofuranboronic acid MIDA ester Basic information |
| Product Name: | 2-(Benzofuran-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 2-Benzofuranboronic acid MIDA ester | | Synonyms: | 2-(Benzofuran-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 2-Benzofuranboronic acid MIDA ester;2-Benzofuranylboronic acid MIDA ester;2-Benzofuranylboronic acid MIDA ester 97%;8-(Benzofuran-2-yl)-4-methyl-2,6-dioxohexahydro-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborol-4-ium-8-uide;2-(1-benzofuran-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione;8-(Benzofuran-2-yl)-4-methyldihydro-4l4,8l4-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborole-2,6(3H,5H)-dione;2-Benzofuranboronic acid MIDA ester;Benzofuran-2-boronic acid methyliminodiacetic acid ester | | CAS: | 1104637-65-1 | | MF: | C13H12BNO5 | | MW: | 273.05 | | EINECS: | | | Product Categories: | | | Mol File: | 1104637-65-1.mol |  |
| | 2-(Benzofuran-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 2-Benzofuranboronic acid MIDA ester Chemical Properties |
| Melting point | 198-202 °C | | form | powder | | InChI | 1S/C13H12BNO5/c1-15-7-12(16)19-14(20-13(17)8-15)11-6-9-4-2-3-5-10(9)18-11/h2-6H,7-8H2,1H3 | | InChIKey | ASPDKYQZQMDSKZ-UHFFFAOYSA-N | | SMILES | CN1CC(=O)OB(OC(=O)C1)c2cc3ccccc3o2 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 2-(Benzofuran-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 2-Benzofuranboronic acid MIDA ester Usage And Synthesis |
| | 2-(Benzofuran-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 2-Benzofuranboronic acid MIDA ester Preparation Products And Raw materials |
|