| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
2-Chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one manufacturers
|
| | 2-Chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one Basic information |
| Product Name: | 2-Chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one | | Synonyms: | 2-Chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one, Tech.;2-CHLORO-1-(4,5-DICHLORO-2-THIENYL)ETHAN-1-ONE: OR =80%;Ethanone, 2-chloro-1-(4,5-dichloro-2-thienyl)-;Rivaroxaban Impurity 130;Avatrombopag Impurity 78;2-Chloro-1-(4,5-dichloro-2-thienyl)ethanone;2-chloro-1-(4,5-dichlorothiophen-2-yl)ethanone;Avatrhopal 78 | | CAS: | 64218-50-4 | | MF: | C6H3Cl3OS | | MW: | 229.51 | | EINECS: | | | Product Categories: | | | Mol File: | 64218-50-4.mol |  |
| | 2-Chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one Chemical Properties |
| Melting point | 61-62 °C | | Boiling point | 355.8±42.0 °C(Predicted) | | density | 1.574±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C6H3Cl3OS/c7-2-4(10)5-1-3(8)6(9)11-5/h1H,2H2 | | InChIKey | OUAXIWPMWPAZMA-UHFFFAOYSA-N | | SMILES | C(=O)(C1SC(Cl)=C(Cl)C=1)CCl |
| | 2-Chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one Usage And Synthesis |
| | 2-Chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one Preparation Products And Raw materials |
|