|
|
| | 4-(4-Chloro-2-thienyl)-2-thiazolamine Basic information |
| Product Name: | 4-(4-Chloro-2-thienyl)-2-thiazolamine | | Synonyms: | 2-ThiazolaMine, 4-(4-chloro-2-thienyl)-;2-ThiazolaMine, 4-(4-chloro-2-thienyl)- 2-ThiazolaMine, 4-(4-chloro-2-thienyl)-;4-(4-Chloro-2-thienyl)-2-thiazolamine;2-Amino-4-(4-chlorothiophen-2-yl)thiazole;4-(4-chlorothiophen-2-yl)-1,3-thiazol-2-amine;4-(4-Chlorothiophen-2-yl)thiazol-2-amine;Avatrombopag Impurity 8;2-ThiazolaMine, 4-(4-chloro-2-thienyl)- 2-ThiazolaMine | | CAS: | 570407-10-2 | | MF: | C7H5ClN2S2 | | MW: | 216.71 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 570407-10-2.mol |  |
| | 4-(4-Chloro-2-thienyl)-2-thiazolamine Chemical Properties |
| Boiling point | 395.3±27.0 °C(Predicted) | | density | 1.535±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 3.47±0.10(Predicted) | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C7H5ClN2S2/c8-4-1-6(11-2-4)5-3-12-7(9)10-5/h1-3H,(H2,9,10) | | InChIKey | SMBPGSKGPGBYBQ-UHFFFAOYSA-N | | SMILES | S1C=C(C2SC=C(Cl)C=2)N=C1N |
| | 4-(4-Chloro-2-thienyl)-2-thiazolamine Usage And Synthesis |
| Uses | 4-(4-Chloro-2-thienyl)-2-thiazolamine can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development processes and chemical production processes. | | Synthesis | 
Bromine was added to an ether solution of 4-chloro-2-acetylthiophene under ice cooling, and the mixture was stirred at room temperature for 2 hours to obtain a brominated compound. Thiourea was added to an EtOH solution of the brominated compound at room temperature, and the mixture was stirred overnight at 80℃ to obtain 2-amino-4-(4-chlorothiophen-2-yl)thiazole. |
| | 4-(4-Chloro-2-thienyl)-2-thiazolamine Preparation Products And Raw materials |
|