| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 6-Dimethylamino-1-hexanol Basic information |
| Product Name: | 6-Dimethylamino-1-hexanol | | Synonyms: | 1-Hexanol,6-(dimethylamino)-;dimethylaminohexanol;6-(DIMETHYLAMINO) HEXANOL-1;6-(Dimethylamino);6-DIMETHYLAMINO-1-HEXANOL 97+%;6-dimethylaminohexan-1-ol;(6-Hydroxyhexyl)diMethylaMine;6-(DiMethylaMino)hexanol | | CAS: | 1862-07-3 | | MF: | C8H19NO | | MW: | 145.24 | | EINECS: | 404-680-3 | | Product Categories: | Aliphatics;Amines;Inhibitors | | Mol File: | 1862-07-3.mol |  |
| | 6-Dimethylamino-1-hexanol Chemical Properties |
| Boiling point | 117 °C / 12mmHg | | density | 0,88 g/cm3 | | refractive index | 1.4460-1.4500 | | storage temp. | Refrigerator | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | pka | 15.19±0.10(Predicted) | | color | Colourless Liquid | | InChI | InChI=1S/C8H19NO/c1-9(2)7-5-3-4-6-8-10/h10H,3-8H2,1-2H3 | | InChIKey | QCXNXRUTKSIZND-UHFFFAOYSA-N | | SMILES | C(O)CCCCCN(C)C | | EPA Substance Registry System | 1-Hexanol, 6-(dimethylamino)- (1862-07-3) |
| | 6-Dimethylamino-1-hexanol Usage And Synthesis |
| Chemical Properties | Clear Colorless Liquid | | Uses | An alkanolamine as lysosomotropic agent and choline uptake inhibitor. |
| | 6-Dimethylamino-1-hexanol Preparation Products And Raw materials |
|