|
|
| | N-Carbobenzyloxy-L-proline methyl ester Basic information |
| | N-Carbobenzyloxy-L-proline methyl ester Chemical Properties |
| Boiling point | 375.0±42.0 °C(Predicted) | | density | 1.175 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5217(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | Liquid | | pka | -3.40±0.40(Predicted) | | color | Colorless to light yellow | | Optical Rotation | [α]22/D 36.8°, neat | | Major Application | peptide synthesis | | InChI | 1S/C14H17NO4/c1-18-13(16)12-8-5-9-15(12)14(17)19-10-11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3/t12-/m0/s1 | | InChIKey | BLQYEDXWEDWCNJ-LBPRGKRZSA-N | | SMILES | COC(=O)[C@@H]1CCCN1C(=O)OCc2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | N-Carbobenzyloxy-L-proline methyl ester Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Carbobenzyloxy-L-proline methyl ester Preparation Products And Raw materials |
|