| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | L-(+)-Glutamic acid hydrochloride Basic information |
| | L-(+)-Glutamic acid hydrochloride Chemical Properties |
| Melting point | 214 °C (dec.)(lit.) | | alpha | 25.5 º (c=10, 2N HCl) | | density | 1.525 | | bulk density | 630kg/m3 | | refractive index | 24 ° (C=6, H2O) | | storage temp. | Store below +30°C. | | solubility | H2O: 1 M at 20 °C, clear, colorless | | form | Crystals For Fine Crystalline Powder | | color | White | | Odor | at 100.00%. odorless | | Water Solubility | 490 g/L (20 ºC) | | Sensitive | Hygroscopic | | Merck | 14,4469 | | BRN | 3565569 | | Stability: | Hygroscopic | | InChI | 1S/C5H9NO4.ClH/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H/t3-;/m0./s1 | | InChIKey | RPAJSBKBKSSMLJ-DFWYDOINSA-N | | SMILES | Cl.N[C@@H](CCC(O)=O)C(O)=O | | LogP | -1.435 (est) | | CAS DataBase Reference | 138-15-8(CAS DataBase Reference) | | EPA Substance Registry System | L-Glutamic acid, hydrochloride (138-15-8) |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | RIDADR | UN 1789 8/PG 3 | | WGK Germany | 3 | | F | 3-10 | | TSCA | TSCA listed | | HS Code | 29224200 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1 |
| | L-(+)-Glutamic acid hydrochloride Usage And Synthesis |
| Chemical Properties | white crystals or fine crystalline powder | | Uses | Glutamic Acid Hydrochloride is a flavoring, salt substitute that is soluble in water and very slightly soluble in alcohol and ether. It is obtained by chemical synthesis. | | Uses | L-Glutamic acid hydrochloride is used as a digestive aid. It is used in cell culture as a component of MEM non-essential amino acids solution. It has been used as a nitrogen source in the culture of Aspergillus fumigatus NRRL 2436 for fumagillin production. | | General Description | L-glutamate is the major excitatory neurotransmitter in mammalian central nervous system (CNS). It interacts with membrane bound glutamate receptors. | | Biochem/physiol Actions | L-glutamate plays key roles in development, learning, memory, plasticity and cognition. It plays crucial role in the pathogenesis of neuropathological diseases such as epilepsy, schizophrenia, stroke, ischemia, ALS (amyotrophic lateral sclerosis), Huntington′s disease and Parkinson′s disease. Glutamate is also responsible for the activation of long-term potentiation (LTP) and long-term depression (LTD). Induction of glutamate receptors plays a key role in the pathophysiology of migraine. |
| | L-(+)-Glutamic acid hydrochloride Preparation Products And Raw materials |
|