| Company Name: |
Finetech Industry Limited |
| Tel: |
+86-27-8746-5837 +86-18627785180 |
| Email: |
info@finetechnology-ind.com |
| Products Intro: |
Product Name:(22R)-5α,17α-Dihydroxy-6α,7α:22,26-diepoxyergosta-2,24-diene-1,26-dione
CAS:27570-38-3
Purity:98% Package:1g,10g,25g,100g,500g,1kg
|
|
|
|
|
(22R)-5α,17α-Dihydroxy-6α,7α:22,26-diepoxyergosta-2,24-diene-1,26-dione manufacturers
- Withanone 27570-38-3
-
- $25.00
-
2022-02-14
- CAS:27570-38-3
- Min. Order: 1g
- Purity: ≥98%
- Supply Ability: 1000.00 kgs
|
| | (22R)-5α,17α-Dihydroxy-6α,7α:22,26-diepoxyergosta-2,24-diene-1,26-dione Basic information |
| Product Name: | (22R)-5α,17α-Dihydroxy-6α,7α:22,26-diepoxyergosta-2,24-diene-1,26-dione | | Synonyms: | (22R)-5α,17α-Dihydroxy-6α,7α:22,26-diepoxyergosta-2,24-diene-1,26-dione;(22R)-6α,7α-Epoxy-5,17,22-trihydroxy-1-oxo-5α-ergosta-2,24-dien-26-oic acid δ-lactone;WITHANONE(SH)(NEW);(5a,6a,7a,22R)-6,7-Epoxy-5,17,22-trihydroxy-1-oxoergosta-2,24-dien-26-oic acid d-lactone;NSC 179884;WITHANONE(SH);Withanone 27570-38-3;Ergosta-2,24-dien-26-oic acid, 6,7-epoxy-5,17,22-trihydroxy-1-oxo-, δ-lactone, (5α,6α,7α,22R)- | | CAS: | 27570-38-3 | | MF: | C28H38O6 | | MW: | 470.6 | | EINECS: | | | Product Categories: | | | Mol File: | 27570-38-3.mol |  |
| | (22R)-5α,17α-Dihydroxy-6α,7α:22,26-diepoxyergosta-2,24-diene-1,26-dione Chemical Properties |
| Boiling point | 653.7±55.0 °C(Predicted) | | density | 1.264 | | Fp | 216℃ | | storage temp. | -20°C | | solubility | Chloroform: soluble,Ethyl Acetate: slightly soluble,Methanol: slightly soluble | | form | Solid | | pka | 12.98±0.70(Predicted) | | color | White to off-white | | InChIKey | FAZIYUIDUNHZRG-PCTWTJKKSA-N | | SMILES | O=C1[C@@]2(C)[C@]([C@@H](O3)[C@@H]3[C@]4([H])[C@]2([H])CC[C@@]5(C)[C@@]4([H])CC[C@@]5([C@H](C)[C@]6([H])OC(C(C)=C(C)C6)=O)O)(O)CC=C1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (22R)-5α,17α-Dihydroxy-6α,7α:22,26-diepoxyergosta-2,24-diene-1,26-dione Usage And Synthesis |
| Uses | Withanone is used in biological studies as it has therapeutic uses resulting in the reductase inhibition for cancer chemoprevention. | | in vivo | Withanone (5-20 mg/kg; oral administration; daily; for 21 days; male Wistar rats) treatment shows significant improvement in the cognitive skill by inhibiting amyloid β-42 and attenuates the elevated levels of pro-inflammatory cytokines like TNF α, IL-1β, IL-6, MCP-1, Nitric oxide, lipid peroxidation and both β- and γ- secretase enzymatic activity. Administration of Withanone also significantly reverses the decline in acetyl choline and Glutathione (GSH) activity[1]. | Animal Model: | Male Wistar rats (20-24 weeks; 320-360 g) received ICV injection of STZ[1] | | Dosage: | 5 mg/kg, 10 mg/kg and 20 mg/kg | | Administration: | Oral administration; daily; for 21 days | | Result: | Showed significant improvement in the cognitive skill by inhibiting amyloid β-42 and attenuated the elevated levels of pro-inflammatory cytokines like TNF alpha, IL-1β, IL-6, MCP-1, Nitric oxide, lipid peroxidation and both β- and γ- secretase enzymatic activity. Also significantly reversed the decline in acetyl choline and Glutathione (GSH) activity.
|
| | IC 50 | NMDA Receptor |
| | (22R)-5α,17α-Dihydroxy-6α,7α:22,26-diepoxyergosta-2,24-diene-1,26-dione Preparation Products And Raw materials |
|