|
|
| | Poly-L-ornithine hydrobromide Basic information |
| | Poly-L-ornithine hydrobromide Chemical Properties |
| storage temp. | -20°C | | form | Solid | | color | White to off-white | | biological source | synthetic | | InChI | 1S/C5H12N2O2.BrH/c6-3-1-2-4(7)5(8)9;/h4H,1-3,6-7H2,(H,8,9);1H | | InChIKey | GWRQMKDBBHFVIZ-UHFFFAOYSA-N | | SMILES | [Br-].NC(CCCN)C(=O)O.[H+] |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Poly-L-ornithine hydrobromide Usage And Synthesis |
| Uses | Poly-L-ornithine hydrobromide has been used to coat coverslips in culture vessels for culturing neural progenitor cells. It has also been used to coat culture plates for culturing cerebral cells of mice. | | General Description | Poly-L-ornithine is a positively charged synthetic amino acid polymer. | | Biochem/physiol Actions | Poly-L-ornithine helps to improve the penetration of substances into cells. It can induce the uptake of DNA. |
| | Poly-L-ornithine hydrobromide Preparation Products And Raw materials |
|