- L-DOPA-2,5,6-D3
-
- $69.00
-
2026-05-11
- CAS:53587-29-4
- Purity:
- Supply Ability: 10g
|
| | 3-(3,4-DIHYDROXYPHENYL-2,5,6-D3)-L-ALANINE Basic information |
| Product Name: | 3-(3,4-DIHYDROXYPHENYL-2,5,6-D3)-L-ALANINE | | Synonyms: | 3-(3,4-DIHYDROXYPHENYL-2,5,6-D3)-L-ALANINE;L-Dopa-2,5,6-d3 [3-(3,4-dihydroxyphenyl-2,5,6-d3)-L-alanine];L-DOPA-RING-D3, 98+ ATOM % D;3-Hydroxy-L-tyrosine-d3;Bendopa-d3;Deadopa-d3;Dopaflex-d3;Dopaidan-d3 | | CAS: | 53587-29-4 | | MF: | C9H8D3NO4 | | MW: | 200.21 | | EINECS: | | | Product Categories: | Amino Acids & Derivatives;Intermediates & Fine Chemicals;Standards - 13C & 2H for GC-Mass Spectrometry;Amino Acids 13C, 2H, 15N;Isotope Labelled Compounds;Isotope Labeled Compounds;Neurochemicals;Pharmaceuticals | | Mol File: | 53587-29-4.mol |  |
| | 3-(3,4-DIHYDROXYPHENYL-2,5,6-D3)-L-ALANINE Chemical Properties |
| Melting point | 292 °C (dec.)(lit.) | | Boiling point | 448.390±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.468±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | solubility | Aqueous Acid (Sparingly) | | form | Solid | | pka | 2.240±0.20(predicted) | | color | White to Off-White | | Optical Rotation | [α]27/D 11.5°, c = 5 in 1 M HCl | | Water Solubility | Water: sparingly soluble | | Stability: | Light Sensitive | | InChI | 1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m0/s1/i1D,2D,4D | | InChIKey | WTDRDQBEARUVNC-UOCCHMHCSA-N | | SMILES | [2H]c1c([2H])c(C[C@H](N)C(O)=O)c([2H])c(O)c1O | | CAS DataBase Reference | 53587-29-4 | | CAS Number Unlabeled | 59-92-7 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-(3,4-DIHYDROXYPHENYL-2,5,6-D3)-L-ALANINE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | L-Dopa-(phenyl-d3) or (3-(3,4-dihydroxyphenyl-2,5,6-d3)-L-alanine) can be used as an internal standard for the quantification of methyldopa in human plasma by LC-MS-MS based method. | | Uses | Natural isomer of the immediate precursor of dopamine; product of tyrsine hydroxylase | | IC 50 | D3 Receptor |
| | 3-(3,4-DIHYDROXYPHENYL-2,5,6-D3)-L-ALANINE Preparation Products And Raw materials |
|