- Cholesteryl chloride
-
- $0.00 / 1kg
-
2026-04-17
- CAS:910-31-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20ton
- Cholesteryl chloride
-
- $2.00 / 1kg
-
2026-04-14
- CAS:910-31-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 200 KG/M
- Cholesteryl chloride
-
- $0.00 / 1KG
-
2025-12-24
- CAS:910-31-6
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000KG
|
| | Cholesteryl chloride Basic information |
| Product Name: | Cholesteryl chloride | | Synonyms: | CHOLESTERYL CHLORIDE 98%;CHOLESTERYL CHLORIDE(REAGENT / STANDARD GRADE);Cholesterylchloride,98%;3-b-Chlorocholest-5-ene.;CHOLESTERYLBETA-CHLORIDE;CHOLESTERYLCHLORIDE(CHOLESTEROLCHLORIDE);Cholest-5-ene, 3-chloro-, (3b)-;Cholesteryl Chloride from Beef Fat | | CAS: | 910-31-6 | | MF: | C27H45Cl | | MW: | 405.1 | | EINECS: | 213-004-4 | | Product Categories: | Steroids;Organics | | Mol File: | 910-31-6.mol |  |
| | Cholesteryl chloride Chemical Properties |
| Melting point | 94-96 °C (lit.) | | alpha | -30 º (c=1, chloroform) | | Boiling point | 488.29°C (rough estimate) | | density | 0.9160 (rough estimate) | | refractive index | 1.6281 (estimate) | | storage temp. | Store below +30°C. | | form | powder | | Optical Rotation | [α]25/D 24°, c = 1 in chloroform | | BRN | 2703655 | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChIKey | OTVRYZXVVMZHHW-DPAQBDIFSA-N | | SMILES | [C@@]12([H])CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@H](Cl)CC3=CC[C@@]21[H] |&1:0,4,5,13,17,19,23,29,r| | | LogP | 11.576 (est) | | CAS DataBase Reference | 910-31-6(CAS DataBase Reference) | | NIST Chemistry Reference | Cholest-5-ene, 3beta-chloro(910-31-6) | | EPA Substance Registry System | Cholest-5-ene, 3-chloro-, (3.beta.)- (910-31-6) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29035990 | | Storage Class | 11 - Combustible Solids |
| | Cholesteryl chloride Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | Cholesteryl chloride is an organochloride derivative of Cholesterol (HY-N0322). Cholesteryl chloride can be used in some hair colors, make-ups, and some other cosmetic preparations[1]. | | References | [1] Ishimaru C, et al. Cholesterol hemisuccinate: a selective inhibitor of family X DNA polymerases. Biochem Biophys Res Commun. 2007 Mar 9;354(2):619-25. DOI:10.1016/j.bbrc.2007.01.034 |
| | Cholesteryl chloride Preparation Products And Raw materials |
|