|
|
| | 4,4'-DINITRODIPHENYL ETHER Basic information |
| | 4,4'-DINITRODIPHENYL ETHER Chemical Properties |
| Melting point | 140-145 °C(lit.) | | Boiling point | 403.46°C (rough estimate) | | density | 1.3933 (rough estimate) | | refractive index | 1.6360 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | Light yellow to Amber to Dark green | | Henry's Law Constant | 5.4×103 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | InChI | 1S/C12H8N2O5/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18/h1-8H | | InChIKey | MWAGUKZCDDRDCS-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(Oc2ccc(cc2)[N+]([O-])=O)cc1 | | CAS DataBase Reference | 101-63-3(CAS DataBase Reference) | | EPA Substance Registry System | Bis(4-nitrophenyl) ether (101-63-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | RTECS | KN3450000 | | TSCA | TSCA listed | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | | Toxicity | mmo-sat 50 mg/plate CRNGDP 6,1811,85 |
| | 4,4'-DINITRODIPHENYL ETHER Usage And Synthesis |
| Chemical Properties | Light yellow solid | | Synthesis Reference(s) | Tetrahedron Letters, 23, p. 4311, 1982 DOI: 10.1016/S0040-4039(00)85587-2 | | Safety Profile | Mutation data reported. Whenheated to decomposition it emits toxic vapors of NOx. |
| | 4,4'-DINITRODIPHENYL ETHER Preparation Products And Raw materials |
|