|
|
| | H-ALA-AMC TFA Basic information |
| Product Name: | H-ALA-AMC TFA | | Synonyms: | L-Alanine-4-methyl-7-coumarinylamide trifluoroacetate salt;L-Alanine-4-methyl-7-coumarinylamide trifluoroacetateL-Alanine-7-amido-4-methylcoumarin trifluoroacetate salt;L-Alanine 7-amido-4-methylcoumarin trifluoroacetat;L-ALANINE-7-AMINO-4-METHYLCOUMARIN TRIFLUOROACETATE SALT;L-Alanine-7-amido-4-methylcoumarin trifluoroacetic acid salt;(S)-2-Amino-N-(4-methyl-2-oxo-2H-chromen-7-yl)propanamide 2,2,2-trifluoroacetate;L-Ala-AMC·TFA;(S)2-methyl-N-(4-methyl-2-oxo-chromen-7-yl)propanamide | | CAS: | 96594-10-4 | | MF: | C15H15F3N2O5 | | MW: | 360.29 | | EINECS: | | | Product Categories: | substrate | | Mol File: | 96594-10-4.mol |  |
| | H-ALA-AMC TFA Chemical Properties |
| Melting point | 200-206 °C | | storage temp. | -20°C | | solubility | ethanol: 50 mg/mL, clear, colorless | | form | powder | | color | White | | Water Solubility | water: 50mg/mL, clear, colorless to very faintly yellow | | InChI | 1S/C13H14N2O3.C2HF3O2/c1-7-5-12(16)18-11-6-9(3-4-10(7)11)15-13(17)8(2)14;3-2(4,5)1(6)7/h3-6,8H,14H2,1-2H3,(H,15,17);(H,6,7)/t8-;/m0./s1 | | InChIKey | YYGKKBUKGNFDJW-QRPNPIFTSA-N | | SMILES | OC(=O)C(F)(F)F.C[C@H](N)C(=O)Nc1ccc2C(C)=CC(=O)Oc2c1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29322090 | | Storage Class | 11 - Combustible Solids |
| | H-ALA-AMC TFA Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | Fluorogenic peptidase substrate, hydrolysis results in longer wavelength excitation and emission spectrum (ex 380nm, em 440nm). |
| | H-ALA-AMC TFA Preparation Products And Raw materials |
|