| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | L-Methionine 4-methyl-7-coumarinylamide trifluoroacetate Basic information |
| | L-Methionine 4-methyl-7-coumarinylamide trifluoroacetate Chemical Properties |
| storage temp. | 2-8°C | | form | White to off white powder | | color | White to off-white | | Optical Rotation | [α]20/D +68±3°, c = 1% in methanol | | InChI | 1S/C15H18N2O3S.C2HF3O2/c1-9-7-14(18)20-13-8-10(3-4-11(9)13)17-15(19)12(16)5-6-21-2;3-2(4,5)1(6)7/h3-4,7-8,12H,5-6,16H2,1-2H3,(H,17,19);(H,6,7)/t12-;/m0./s1 | | InChIKey | VSAUWUJWXBUSEU-YDALLXLXSA-N | | SMILES | OC(=O)C(F)(F)F.CSCC[C@H](N)C(=O)Nc1ccc2C(C)=CC(=O)Oc2c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10 | | HS Code | 2932209090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | L-Methionine 4-methyl-7-coumarinylamide trifluoroacetate Usage And Synthesis |
| Uses | Substrate for calpain. |
| | L-Methionine 4-methyl-7-coumarinylamide trifluoroacetate Preparation Products And Raw materials |
|