| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,6-Dichloro-4-methoxypyridazine Basic information |
| | 3,6-Dichloro-4-methoxypyridazine Chemical Properties |
| Melting point | 130-131 °C(Solv: ethanol, 50% (64-17-5)) | | Boiling point | 314.1±37.0 °C(Predicted) | | density | 1.446±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -0.02±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H4Cl2N2O/c1-10-3-2-4(6)8-9-5(3)7/h2H,1H3 | | InChIKey | ODKKBTJZLBPUGU-UHFFFAOYSA-N | | SMILES | C1(Cl)=NN=C(Cl)C=C1OC |
| | 3,6-Dichloro-4-methoxypyridazine Usage And Synthesis |
| | 3,6-Dichloro-4-methoxypyridazine Preparation Products And Raw materials |
|