|
|
| | 3-(2-(pyridin-3-yl)disulfanyl)pyridine Basic information |
| Product Name: | 3-(2-(pyridin-3-yl)disulfanyl)pyridine | | Synonyms: | 3-(2-(pyridin-3-yl)disulfanyl)pyridine;3-(PYRIDIN-3-YLDISULFANYL)PYRIDINE;3-(2-(pyridine-3-yl)disulfanyl)pyridine;Pyridine, 3,3'-dithiobis-;TAK438 Impurity 119;Vonoprazan Impurity 123;Vonoprazan Impuirty 90;Vonoprazan Impurity N27 | | CAS: | 24367-50-8 | | MF: | C10H8N2S2 | | MW: | 220.31 | | EINECS: | | | Product Categories: | | | Mol File: | 24367-50-8.mol |  |
| | 3-(2-(pyridin-3-yl)disulfanyl)pyridine Chemical Properties |
| Boiling point | 180-183 °C(Press: 4 Torr) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.44±0.11(Predicted) | | InChI | InChI=1S/C10H8N2S2/c1-3-9(7-11-5-1)13-14-10-4-2-6-12-8-10/h1-8H | | InChIKey | YURPISYZTZHYBW-UHFFFAOYSA-N | | SMILES | S(C1=CC=CN=C1)SC1=CC=CN=C1 |
| | 3-(2-(pyridin-3-yl)disulfanyl)pyridine Usage And Synthesis |
| Description | 3-(2-(pyridin-3-yl)disulfanyl)pyridine is a Vonoprazan Impurity. Vonoprazan is used to treat gastroesophageal reflux disease (GERD), erosive esophagitis, and H. pylori infections. | | Uses | 1,2-Di(pyridin-3-yl)disulfane is a useful research chemical used in the synthesis of disulfides and diselenides by copper-catalyzed coupling reactions of aryl halides and sulfur or selenium in water. |
| | 3-(2-(pyridin-3-yl)disulfanyl)pyridine Preparation Products And Raw materials |
|