| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | BenzaMide, 2-[(3-iodo-1H-indazol-6-yl)thio]-N-Methyl- Basic information |
| Product Name: | BenzaMide, 2-[(3-iodo-1H-indazol-6-yl)thio]-N-Methyl- | | Synonyms: | BenzaMide, 2-[(3-iodo-1H-indazol-6-yl)thio]-N-Methyl-;2-(3-iodo-1H-indazol-6-ylthio)-N-MethylbenzaMide;2-[(3-Iodo-1H-indazol-6-yl)sulfanyl]-N-methylbenzamide;Axitinib Impurity f;Axitinib impurity H;Axitinib Impurity 2/2-[(3-iodo-2H-indazol-6-yl)sulfanyl]-N-methylbenzamide;2-[(3-iodo-2H-indazol-6-yl)sulfanyl]-N-methylbenzamide;Axitinib Impurity O | | CAS: | 885126-34-1 | | MF: | C15H12IN3OS | | MW: | 409.25 | | EINECS: | | | Product Categories: | Intermediate | | Mol File: | 885126-34-1.mol | ![BenzaMide, 2-[(3-iodo-1H-indazol-6-yl)thio]-N-Methyl- Structure](CAS/GIF/885126-34-1.gif) |
| | BenzaMide, 2-[(3-iodo-1H-indazol-6-yl)thio]-N-Methyl- Chemical Properties |
| Boiling point | 613.9±45.0 °C(Predicted) | | density | 1.80±0.1 g/cm3(Predicted) | | pka | 11.06±0.40(Predicted) | | InChI | InChI=1S/C15H12IN3OS/c1-17-15(20)11-4-2-3-5-13(11)21-9-6-7-10-12(8-9)18-19-14(10)16/h2-8H,1H3,(H,17,20)(H,18,19) | | InChIKey | VHZLHFNNNDGPLF-UHFFFAOYSA-N | | SMILES | C(NC)(=O)C1=CC=CC=C1SC1=CC2=C(C=C1)C(I)=NN2 |
| | BenzaMide, 2-[(3-iodo-1H-indazol-6-yl)thio]-N-Methyl- Usage And Synthesis |
| Description | 2-[(3-Iodo-1H-indazol-6-yl)sulfanyl]-N-methylbenzamide is a palladium catalyst for the synthesis of 2-[(3-iodo-1H-indazol-6-yl)sulfanyl]benzoic acid from 3,4 dinitrobenzoyl chloride and 1,2 dimethoxyethane. The reaction proceeds via a nucleophilic substitution reaction with the sulfonyl halide. The Iodo group can be replaced by other groups such as bromine, chlorine or fluorine in order to synthesize different derivatives of the compound. | | Synthesis | Synthesis of 2-((3-Iodo-1H-indazol-6-yl)thio)-N-methylbenzamide from 3,6-Diiodo-1H-indazole and 2-Mercapto-N-methylbenzamide.![BenzaMide, 2-[(3-iodo-1H-indazol-6-yl)thio]-N-Methyl-synthesis route BenzaMide, 2-[(3-iodo-1H-indazol-6-yl)thio]-N-Methyl-synthesis route](/NewsImg/2023-11-07/6383495047206259015769226.png)
|
| | BenzaMide, 2-[(3-iodo-1H-indazol-6-yl)thio]-N-Methyl- Preparation Products And Raw materials |
|