|
|
| | Pseudolaric acid B-glucopyranoside Basic information |
| Product Name: | Pseudolaric acid B-glucopyranoside | | Synonyms: | Pseudolaric acid B-glucopyranoside;Pseudolaric acid B beta-D-glucoside;β-D-Glucopyranose, 1-[(2E,4E)-5-[(3R,4S,4aS,9aR)-4a-(acetyloxy)-3,4,4a,5,6,9-hexahydro-7-(methoxycarbonyl)-3-methyl-1-oxo-1H-4,9a-ethanocyclohepta[c]pyran-3-yl]-2-methyl-2,4-pentadienoate];Pseudolaric acid B-O-β-D- glucopyranoside;Pseudolaric acid B β-D-glucoside;Pseudolaric acid B βDglucoside,Inhibitor,inhibit,Pseudolaric acid B β D glucoside;Pseudolaric acid B-glucopyranoside-RM;Pseudolaric acid B β-D-glucoside, 10 mM in DMSO | | CAS: | 98891-41-9 | | MF: | C29H38O13 | | MW: | 594.6 | | EINECS: | | | Product Categories: | | | Mol File: | 98891-41-9.mol |  |
| | Pseudolaric acid B-glucopyranoside Chemical Properties |
| Boiling point | 766.5±60.0 °C(Predicted) | | density | 1.42±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | form | Solid | | pka | 12.52±0.70(Predicted) | | color | White to off-white | | InChIKey | UUDZDKPKXAEKLA-YHLOYHKPSA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)OC(=O)\C(=C\C=C\[C@]2(OC(=O)[C@]43[C@@]([C@H]2CC4)(CCC(=CC3)C(=O)OC)OC(=O)C)C)\C |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Repr. 2 |
| | Pseudolaric acid B-glucopyranoside Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO. It is derived from the root bark of Pseudolarix kamepferi Gord; Pseudolarix amabilis (Nelson) Rehd. | | Uses | Pseudolaric Acid B O-β-D-Glucopyranoside is a metabolites of diterpene acid isolated from Pseudolarix kaempferi. A cytotoxic agent and a potential antifungal agent. |
| | Pseudolaric acid B-glucopyranoside Preparation Products And Raw materials |
|