| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Tetrabutylammonium triflate Basic information |
| | Tetrabutylammonium triflate Chemical Properties |
| Melting point | 110-114 °C
112-113 °C (lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | methanol: 0.1 g/mL, clear, colorless | | form | powder to crystal | | color | White to Almost white | | Sensitive | Hygroscopic | | BRN | 4172978 | | InChI | 1S/C16H36N.CHF3O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)8(5,6)7/h5-16H2,1-4H3;(H,5,6,7)/q+1;/p-1 | | InChIKey | YNJQKNVVBBIPBA-UHFFFAOYSA-M | | SMILES | [O-]S(=O)(=O)C(F)(F)F.CCCC[N+](CCCC)(CCCC)CCCC | | CAS DataBase Reference | 35895-70-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Harmful/Irritant/Hygroscopic | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids |
| | Tetrabutylammonium triflate Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder, crystals or | | Uses | Used as a catalyst for the reactions of condensation of alcohols and carboxylic acids, reaction of aromatic compounds with sulfonyl chlorides, cracking of alkanes, alkylation of alkenes, isomerisation of alkanes and trans-alkylation of aromatics, trans-bromination and other Friedel-Crafts reactions. |
| | Tetrabutylammonium triflate Preparation Products And Raw materials |
|