2,4,6-Trimethoxyaniline hydrochloride manufacturers
|
| | 2,4,6-Trimethoxyaniline hydrochloride Basic information |
| Product Name: | 2,4,6-Trimethoxyaniline hydrochloride | | Synonyms: | Benzenamine,2,4,6-trimethoxy-, hydrochloride (1:1);Benzenamine,2,4,6-trimethoxy-, hydrochloride;2,4,6-trimethoxybenzeneaminehydrochloride;2,4,6-Trimethoxyaniline hydrochloride | | CAS: | 102438-99-3 | | MF: | C9H14ClNO3 | | MW: | 219.67 | | EINECS: | | | Product Categories: | Amines;Phenyls & Phenyl-Het;Phenyls & Phenyl-Het | | Mol File: | 102438-99-3.mol |  |
| | 2,4,6-Trimethoxyaniline hydrochloride Chemical Properties |
| Melting point | 220-225° | | storage temp. | Store at room temperature | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C9H13NO3.ClH/c1-11-6-4-7(12-2)9(10)8(5-6)13-3;/h4-5H,10H2,1-3H3;1H | | InChIKey | GRHAUEFIQOUKAY-UHFFFAOYSA-N | | SMILES | C1(OC)C=C(C=C(OC)C=1N)OC.Cl |
| HazardClass | IRRITANT | | HS Code | 2922290090 |
| | 2,4,6-Trimethoxyaniline hydrochloride Usage And Synthesis |
| | 2,4,6-Trimethoxyaniline hydrochloride Preparation Products And Raw materials |
|