|
|
| | 7-Methoxyoxindole Basic information |
| Product Name: | 7-Methoxyoxindole | | Synonyms: | 7-METHOXY-2-INDOLINONE;7-methoxyindolin-2-one;7-Methoxy-1,3-dihydro-2H-indol-2-one;2H-Indol-2-one, 1,3-dihydro-7-methoxy-;7-(Methylperoxy)-1H-indole;7-Methoxy-2-oxindole;7-Methoxy-2,3-dihydro-1H-indol-2-one;7-methoxy-1,3-dihydroindol-2-one | | CAS: | 7699-20-9 | | MF: | C9H9NO2 | | MW: | 163.17 | | EINECS: | | | Product Categories: | | | Mol File: | 7699-20-9.mol |  |
| | 7-Methoxyoxindole Chemical Properties |
| Melting point | 146 °C(Solv: ethanol (64-17-5)) | | Boiling point | 356.0±42.0 °C(Predicted) | | density | 1.208±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 13.63±0.20(Predicted) | | InChI | InChI=1S/C9H9NO2/c1-12-7-4-2-3-6-5-8(11)10-9(6)7/h2-4H,5H2,1H3,(H,10,11) | | InChIKey | APQCUXBFROFCOM-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2OC)CC1=O |
| | 7-Methoxyoxindole Usage And Synthesis |
| | 7-Methoxyoxindole Preparation Products And Raw materials |
|