| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | trans-2-Bromo-1-indanol Basic information |
| Product Name: | trans-2-Bromo-1-indanol | | Synonyms: | trans-2-BroMo-2,3-dihydro-1H-inden-1-ol;trans-2-BroMo-1-indanol;TRANS-2-BROMO-1-HYDROXYINDANE;1H-Inden-1-ol, 2-bromo-2,3-dihydro-, (1R,2R)-rel-;(1R,2R)-2-bromo-2,3-dihydro-1h-inden-1-ol;trans-2-Bromo-1-indanol | | CAS: | 10368-44-2 | | MF: | C9H9BrO | | MW: | 213.07 | | EINECS: | 226-442-6 | | Product Categories: | | | Mol File: | 10368-44-2.mol |  |
| | trans-2-Bromo-1-indanol Chemical Properties |
| Melting point | 130-131 °C(lit.) | | Boiling point | 318.3±42.0 °C(Predicted) | | density | 1.640±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | crystals | | pka | 13.19±0.40(Predicted) | | InChI | 1S/C9H9BrO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9,11H,5H2/t8-,9-/m0/s1 | | InChIKey | RTESDSDXFLYAKZ-IUCAKERBSA-N | | SMILES | O[C@@H]1[C@@H](Br)Cc2ccccc12 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29062990 | | Storage Class | 11 - Combustible Solids |
| | trans-2-Bromo-1-indanol Usage And Synthesis |
| Chemical Properties | White solid |
| | trans-2-Bromo-1-indanol Preparation Products And Raw materials |
|