|
|
| | alpha-Naphtholphthalein Basic information |
| | alpha-Naphtholphthalein Chemical Properties |
| Melting point | 238-240 °C(lit.) | | Boiling point | 496.21°C (rough estimate) | | density | 1.1532 (rough estimate) | | bulk density | 350kg/m3 | | vapor density | 14.44 (vs air) | | refractive index | 1.6400 (estimate) | | storage temp. | Store below +30°C. | | solubility | Solubility Practically insoluble in water; soluble in ethanol | | form | Powder | | pka | 8.0, 8.2, 8.5(at 25℃) | | color | Pink to beige or brown | | PH Range | 7.1(brownish)-8.3(blue/green) | | Odor | Characteristic odour | | PH | pH : 7.1~8.7 | | Water Solubility | Soluble in ethanol. Insoluble in water. | | λmax | 648nm | | Merck | 14,6389 | | BRN | 97816 | | InChI | 1S/C28H18O4/c29-25-15-13-23(17-7-1-3-9-19(17)25)28(22-12-6-5-11-21(22)27(31)32-28)24-14-16-26(30)20-10-4-2-8-18(20)24/h1-16,29-30H | | InChIKey | HQHBAGKIEAOSNM-UHFFFAOYSA-N | | SMILES | O1C(c6c(cccc6)C1=O)(c4c5c(c(cc4)O)cccc5)c2c3c(c(cc2)O)cccc3 | | CAS DataBase Reference | 596-01-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 32041900 | | Storage Class | 11 - Combustible Solids |
| | alpha-Naphtholphthalein Usage And Synthesis |
| Chemical Properties | pink to beige or brown fine crystalline powder | | Uses | As indicator in 0.1% or 0.04% solution in alcohol. pH 7.3 colorless to reddish; 8.7 greenish to blue. Particularly adapted for weak acids in strong alcoholic solution. | | Uses | alpha-Naphtholphthalein is used in preparation of epoxy resin compound, preparing, laminated board, printed circuit board, and cured product with high heat resistance and flame retardancy. |
| | alpha-Naphtholphthalein Preparation Products And Raw materials |
|