| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:L-Phenylalanine-d2
CAS:221346-31-2
Remarks:CS-C-00207
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:L-Phenylalanine-3,3-d2
CAS:221346-31-2
Purity:98 atom % D Package:100MG Remarks:615889-100MG
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
13636370518 |
| Email: |
shyysw007@163.com |
| Products Intro: |
Product Name:L-PHENYLALANINE-3,3-D2
CAS:221346-31-2
Purity:98%，98atom%D Package:100mg Remarks:S55620
|
|
| | L-PHENYLALANINE-3,3-D2 Basic information |
| Product Name: | L-PHENYLALANINE-3,3-D2 | | Synonyms: | L-PHENYLALANINE-3,3-D2;L-PHENYLALANINE-BETA,BETA-D2;L-Phenylalanine-β,β-d2;L-Phenylalanine-3,3-d?;L-Phenylalanine-3,3-d2;L-Phenylalanine (3,3-D?, 98%);L-Phenylalanine-d2;L-Phenylalanine-D2 (Standard) | | CAS: | 221346-31-2 | | MF: | C9H11NO2 | | MW: | 165.19 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | L-PHENYLALANINE-3,3-D2 Chemical Properties |
| Melting point | 270-275 °C (dec.)(lit.) | | storage temp. | Store at -20°C | | solubility | DMSO : 2.5 mg/mL (14.95 mM; ultrasonic and warming and heat to 60°C) | | form | Solid | | color | White to light yellow | | Optical Rotation | [α]25/D -33.0°, c =1 in H2O | | InChI | 1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i6D2 | | InChIKey | COLNVLDHVKWLRT-RAEURDQOSA-N | | SMILES | [H][C@@](N)(C(O)=O)C([2H])([2H])c1ccccc1 | | CAS Number Unlabeled | 63-91-2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-PHENYLALANINE-3,3-D2 Usage And Synthesis |
| Uses | L-Phenylalanine-3,3-d2 (CAS# 221346-31-2) is a useful isotopically labeled research compound. | | IC 50 | NMDA Receptor |
| | L-PHENYLALANINE-3,3-D2 Preparation Products And Raw materials |
|