|
|
| | BACTERIOCHLOROPHYLL Basic information |
| Product Name: | BACTERIOCHLOROPHYLL | | Synonyms: | ,n24,n25,n26]-,[sp-4-2-[3s-[3alpha(2e,7s,11s),4beta,13beta,14alpha,21beta;-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-n23;magnesium,[3,7,11,15-tetramethyl-2-hexadecenyl9-acetyl-14-ethyl-13,14-dihydro;BACTERIOCHLOROPHYLL;Bacteriochlorophyll from Rhodopseudomonas sphaeroides (under argon);bacteriochlorophyll from rhodopseudomonas sphaeroides;Magnesium, [3,7,11,15-tetramethyl-2-hexadecenyl 9-acetyl-14-ethyl-13,14-dihydro-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-N23,N24,N25,N26]-, [SP-4-2-[3S-[3alpha(2E,7S*,11S*),4beta,13beta,14alpha,21beta]]]-;BACTERIOCHLOROPHYLL FROMRHODOPSEUDOMONAS SPHAEROID | | CAS: | 17499-98-8 | | MF: | C55H74MgN4O6 | | MW: | 911.52 | | EINECS: | 241-507-9 | | Product Categories: | Porphyrins;B;Stains and Dyes;Stains&Dyes, A to;Natural Porphyrins and Derivitives | | Mol File: | 17499-98-8.mol |  |
| | BACTERIOCHLOROPHYLL Chemical Properties |
| storage temp. | -20°C | | solubility | ethanol: 10mg/mL, light green | | form | powder | | color | dark blue
light green to blue-green | | ε(extinction coefficient) | 150-250 at 570-578nm in diethyl ether | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChIKey | DSJXIQQMORJERS-SWPZPYAJNA-M | | SMILES | CC[C@@H]1[C@@H](C)c2cc3c(C(C)=O)c(C)c4cc5nc([C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@@H]5C)c6[C@@H](C(=O)OC)C(=O)c7c(C)c(cc1n2)n([Mg]n34)c67 | | EPA Substance Registry System | Magnesium, [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,13R,14R,21R)-9-acetyl-14-ethyl-13,14-dihydro-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-.kappa.N23,.kappa.N24,.kappa.N25,.kappa.N26]-, (SP-4-2)- (17499-98-8) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | BACTERIOCHLOROPHYLL Usage And Synthesis |
| Uses | Bacteriochlorophyll fromRhodopseudomonas sphaeroides has been used as a standard to calibrate the high performance liquid chromatography (HPLC). | | Definition | A light-absorbing pigment, closely related to chlorophyll. The magnesium at the center of the tetrapyrrole ring is replaced by manganese. | | General Description | Bacteriochlorophylls are photosynthetic pigments, that are present in most of the bacteria. | | Biochem/physiol Actions | Bacteriochlorophyll/BchF or 3-vinyl-bacteriochlorophyll hydratase is an enzyme present in bacteria, which helps in producing bacteriochlorophylla.Bacteriochlorophyllais formed from chlorophyllidea. |
| | BACTERIOCHLOROPHYLL Preparation Products And Raw materials |
|