| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | Propylene glycol dioleate Basic information |
| Product Name: | Propylene glycol dioleate | | Synonyms: | PROPYLENE GLYCOL DIOLEATE;EMALEX PG-DI-O;1-methyl-1,2-ethanediyldioleate;9-Octadecenoicacid(Z)-,1-methyl-1,2-ethanediylester;9-Octadecenoic acid (9Z)-, 1-methyl-1,2-ethanediyl ester;1,2-PROPYLENEGLYCOLDIOLEATE;Bis[(Z)-9-octadecenoic acid]1-methyl-1,2-ethanediyl ester;Propane-1,2-diyl (9Z,9'Z)bis-octadec-9-enoate | | CAS: | 105-62-4 | | MF: | C39H72O4 | | MW: | 604.99 | | EINECS: | 203-315-3 | | Product Categories: | | | Mol File: | 105-62-4.mol |  |
| | Propylene glycol dioleate Chemical Properties |
| Boiling point | 641.2±48.0 °C(Predicted) | | density | 0.907±0.06 g/cm3(Predicted) | | Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT | | InChIKey | UMHYVXGZRGOICM-AUYXYSRISA-N | | SMILES | C(OC(=O)CCCCCCC/C=C\CCCCCCCC)(C)COC(=O)CCCCCCC/C=C\CCCCCCCC | | LogP | 16.260 (est) | | EPA Substance Registry System | 9-Octadecenoic acid (9Z)-, 1-methyl-1,2-ethanediyl ester (105-62-4) |
| | Propylene glycol dioleate Usage And Synthesis |
| Uses | Propylene Glycol Dioleate (PGDD) is an insoluble compound which appears as an oily, viscous yellow to amber colored liquid and finds application as an emulsifier for chemicals used in leather processing and in lubricants. It is also utilized in cosmetics industries for the preparation of skin conditioning agents.
|
| | Propylene glycol dioleate Preparation Products And Raw materials |
|