|
|
| | Copper bis(2-ethylhexanoate) Basic information |
| | Copper bis(2-ethylhexanoate) Chemical Properties |
| Melting point | 252 °C (dec.)(lit.) | | storage temp. | Storage temp. 2-8°C | | form | Powder | | color | blue | | Water Solubility | Soluble in water, alcohols, dichloroethane, chlorobenzene, and most organic solvents. | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Exposure limits | ACGIH: TWA 1 mg/m3
NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3 | | InChI | InChI=1S/2C8H16O2.Cu/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 | | InChIKey | SEKCXMNFUDONGJ-UHFFFAOYSA-L | | SMILES | C(CC)(CCCC)C(=O)O[Cu]OC(=O)C(CC)CCCC | | CAS DataBase Reference | 149-11-1(CAS DataBase Reference) | | EPA Substance Registry System | Cupric 2-ethylhexanoate (149-11-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B |
| | Copper bis(2-ethylhexanoate) Usage And Synthesis |
| Chemical Properties | BLUE-GREEN POWDER | | Uses | Wood preservative, Anti-fungal | | Uses | Copper(II) 2-ethylhexanoate is used as pharmaceutical intermediates. Used as drier/additive for paints, coatings and inks. Used as catalystic special applications in lubricant and grease additives, fuel combustion additives to enhance and stabilize the performance of fuels. Used in the the rubber wire coat compound and the brass-coated steel belt. | | reaction suitability | core: copper
reagent type: catalyst |
| | Copper bis(2-ethylhexanoate) Preparation Products And Raw materials |
|