- Propacetamol
-
-
2026-07-07
- CAS:66532-86-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 1000
|
| | Propacetamol hydrochloride Basic information |
| Product Name: | Propacetamol hydrochloride | | Synonyms: | (4-acetamidophenyl) 2-(diethylamino)acetate hydrochloride;(4-acetamidophenyl) 2-(diethylamino)ethanoate hydrochloride;2-(diethylamino)acetic acid (4-acetamidophenyl) ester hydrochloride;Propacetamol hydroch;PropacetaMol Hydrochloride (asepsis);n,n-diethylglycine 4-(acetylamino)phenyl ester hydrochloride;PROPACETAMOL HYDROCHLORIDE;4-(Acetylamino)phenylN,N-diethylglycinate,9CI. | | CAS: | 66532-86-3 | | MF: | C14H21ClN2O3 | | MW: | 300.78 | | EINECS: | 266-391-7 | | Product Categories: | 66532-86-3 | | Mol File: | 66532-86-3.mol |  |
| | Propacetamol hydrochloride Chemical Properties |
| Melting point | 228° | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Freely soluble in water, slightly soluble in anhydrous ethanol, practically insoluble in acetone. | | form | Solid | | color | White to Off-White | | Water Solubility | H2O: 20mg/mL, clear | | InChI | InChI=1S/C14H20N2O3.ClH/c1-4-16(5-2)10-14(18)19-13-8-6-12(7-9-13)15-11(3)17;/h6-9H,4-5,10H2,1-3H3,(H,15,17);1H | | InChIKey | WGTYJNGARJPYKG-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(NC(=O)C)C=C1)(=O)CN(CC)CC.[H]Cl | | CAS DataBase Reference | 66532-86-3(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Propacetamol hydrochloride Usage And Synthesis |
| Description | Propacetamol is an injectable prodrug of paracetamol, useful in the symptomatic treatment of pain and fever. | | Chemical Properties | White or almost white, crystalline powder. | | Originator | Hexachimie (UPSA) (France) | | Uses | Analgesic; antipyretic. | | Brand name | PRO-DAFALGAN |
| | Propacetamol hydrochloride Preparation Products And Raw materials |
|