|
|
| | 2-Amino-2'-chloro-5-nitro benzophenone Basic information |
| | 2-Amino-2'-chloro-5-nitro benzophenone Chemical Properties |
| Melting point | 119-121°C | | Boiling point | 505.8±45.0 °C(Predicted) | | density | 1.428±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | -3.12±0.36(Predicted) | | form | Powder | | color | Pale yellow to yellow | | Sensitive | Air Sensitive | | BRN | 2814216 | | Major Application | pharmaceutical pharmaceutical small molecule | | InChI | InChI=1S/C13H9ClN2O3/c14-11-4-2-1-3-9(11)13(17)10-7-8(16(18)19)5-6-12(10)15/h1-7H,15H2 | | InChIKey | GRDGBWVSVMLKBV-UHFFFAOYSA-N | | SMILES | C(C1=CC([N+]([O-])=O)=CC=C1N)(C1=CC=CC=C1Cl)=O | | CAS DataBase Reference | 2011-66-7(CAS DataBase Reference) | | NIST Chemistry Reference | Methanone, (2-amino-5-nitrophenyl)(2-chlorophenyl)-(2011-66-7) |
| Hazard Codes | Xi | | Risk Statements | 46-36/37/38 | | Safety Statements | 53-26-36/37-60 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 29223990 | | Storage Class | 11 - Combustible Solids |
| | 2-Amino-2'-chloro-5-nitro benzophenone Usage And Synthesis |
| Chemical Properties | yellow crystal powder | | Uses | 2-Amino-5-nitro-2''-chlorobenzophenone (Clonazepam EP Impurity A) is an impurity of Clonazepam (C587080). |
| | 2-Amino-2'-chloro-5-nitro benzophenone Preparation Products And Raw materials |
|