|
| 2-Amino-2'-chloro-5-nitro benzophenone Basic information |
| 2-Amino-2'-chloro-5-nitro benzophenone Chemical Properties |
Melting point | 119-121°C | Boiling point | 505.8±45.0 °C(Predicted) | density | 1.428±0.06 g/cm3(Predicted) | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | solubility | Chloroform (Slightly), Methanol (Slightly) | pka | -3.12±0.36(Predicted) | form | Powder | color | Pale yellow to yellow | Sensitive | Air Sensitive | BRN | 2814216 | InChI | InChI=1S/C13H9ClN2O3/c14-11-4-2-1-3-9(11)13(17)10-7-8(16(18)19)5-6-12(10)15/h1-7H,15H2 | InChIKey | GRDGBWVSVMLKBV-UHFFFAOYSA-N | SMILES | C(C1=CC([N+]([O-])=O)=CC=C1N)(C1=CC=CC=C1Cl)=O | CAS DataBase Reference | 2011-66-7(CAS DataBase Reference) | NIST Chemistry Reference | Methanone, (2-amino-5-nitrophenyl)(2-chlorophenyl)-(2011-66-7) |
| 2-Amino-2'-chloro-5-nitro benzophenone Usage And Synthesis |
Chemical Properties | yellow crystal powder | Uses | 2-Amino-5-nitro-2''-chlorobenzophenone (Clonazepam EP Impurity A) is an impurity of Clonazepam (C587080). |
| 2-Amino-2'-chloro-5-nitro benzophenone Preparation Products And Raw materials |
|