|
|
| | Adenosine 5'-diphosphate di(monocyclohexylammonium) salt Basic information |
| Product Name: | Adenosine 5'-diphosphate di(monocyclohexylammonium) salt | | Synonyms: | ADP DI(MONOCYCLOHEXYLAMMONIUM) SALT;ADENOSINE 5'-DIPHOSPHATEDI(MONOCYCLOHEXY LAMMONIUM);adenosine 5'-diphosphate bis(cyclohexylammonium) salt;Adenosine 5′-diphosphate bis(cyclohexylammonium) salt,ADP;Adenosine 5'-(trihydrogen diphosphate) cyclohexanamine salt;Adenosine 5`-diphosphate di(dicyclohexyl)aMine salt;Cyclohexanaminium ((2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)meth;CyclohexanaMiniuM ((2R,3S,4R,5R)-5-(6-aMino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)Methyl hydrogendiphosphate | | CAS: | 102029-87-8 | | MF: | C16H28N6O10P2 | | MW: | 526.38 | | EINECS: | | | Product Categories: | | | Mol File: | 102029-87-8.mol |  |
| | Adenosine 5'-diphosphate di(monocyclohexylammonium) salt Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: soluble, clear to slightly hazy, colorless to faintly yellow | | form | crystalline | | color | clear to slightly hazycolorless to faint yellowH2O | | biological source | bacterial | | Water Solubility | H2O: soluble, clear to slightly hazy, colorless to faintly yellow | | InChIKey | SCOUEIPNDLFPCX-IDIVVRGQSA-N | | SMILES | NC1CCCCC1.NC2CCCCC2.Nc3ncnc4n(cnc34)[C@@H]5O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]5O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Adenosine 5'-diphosphate di(monocyclohexylammonium) salt Usage And Synthesis |
| Uses | Adenosine 5′-diphosphate (ADP) is an adenine nucleotide involved in energy storage and nucleic acid metabolism via its conversion into ATP by ATP synthases. ADP affects platelet activation through its interaction with ADP receptors P2Y1, P2Y12 and P2X1. Upon its conversion to adenosine by ecto-ADPases, platelet activation is inhibited via adenosine receptors. |
| | Adenosine 5'-diphosphate di(monocyclohexylammonium) salt Preparation Products And Raw materials |
|