| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 6-Chloroimidazo[1,2-a]pyridine-2-carboxylic acid Basic information |
| | 6-Chloroimidazo[1,2-a]pyridine-2-carboxylic acid Chemical Properties |
| Melting point | 228-229°C | | density | 1.58±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -4.71±0.41(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C8H5ClN2O2/c9-5-1-2-7-10-6(8(12)13)4-11(7)3-5/h1-4H,(H,12,13) | | InChIKey | YZBKAIKDSQEETA-UHFFFAOYSA-N | | SMILES | C12=NC(C(O)=O)=CN1C=C(Cl)C=C2 | | CAS DataBase Reference | 182181-19-7(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 6-Chloroimidazo[1,2-a]pyridine-2-carboxylic acid Usage And Synthesis |
| | 6-Chloroimidazo[1,2-a]pyridine-2-carboxylic acid Preparation Products And Raw materials |
|