|
|
| | 6-CHLOROIMIDAZO[1,2-A]PYRIDINE Basic information |
| | 6-CHLOROIMIDAZO[1,2-A]PYRIDINE Chemical Properties |
| Melting point | 85-87°C | | Boiling point | 132°C/1.5mmHg(lit.) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 5.18±0.50(Predicted) | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C7H5ClN2/c8-6-1-2-7-9-3-4-10(7)5-6/h1-5H | | InChIKey | XQEGYCZJSVFGEE-UHFFFAOYSA-N | | SMILES | C12=NC=CN1C=C(Cl)C=C2 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | 6-CHLOROIMIDAZO[1,2-A]PYRIDINE Usage And Synthesis |
| Uses | 6-Chlorimidazo[1,2-A]pyridine is a pyridine derivative and can be used as a pharmaceutical intermediate. | | Synthesis | General procedure for the synthesis of 6-chloroimidazo[1,2-A]pyridine from chloroacetaldehyde and 2-amino-5-chloropyridine: 2-amino-5-chloropyridine (4.50 g, 35.00 mmol) and 2-chloroacetaldehyde (10.30 g, 52.50 mmol, 8.45 mL) in a solvent mixture of ethanol (50.00 mL) and water (10 mL) were reacted at 80 °C The reaction was stirred for 16 hours. Upon completion of the reaction, the reaction solution was concentrated to dryness and the resulting residue was diluted with water (100 mL) and subsequently extracted with ethyl acetate (150 mL x 2). The organic phases were combined, washed sequentially with water (50 mL × 2) and saturated saline (20 mL), dried over anhydrous sodium sulfate, filtered and concentrated to afford 6-chloroimidazo[1,2-A]pyridine (5.10 g, 33.43 mmol) as a solid product. The structure of the product was confirmed by 1H NMR (400 MHz, CDCl3): δH 8.18 (d, 1H), 7.65 (s, 1H), 7.59-7.50 (m, 2H), 7.12 (dd, 1H). | | References | [1] Patent: WO2018/98500, 2018, A1. Location in patent: Page/Page column 80; 81 |
| | 6-CHLOROIMIDAZO[1,2-A]PYRIDINE Preparation Products And Raw materials |
|