| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- L-Phe-Gly
-
-
2026-09-14
- CAS:721-90-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- H-PHE-GLY-OH
-
- $1.00
-
2020-01-01
- CAS: 721-90-4
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | H-Phe-Gly-OH Basic information |
| Product Name: | H-Phe-Gly-OH | | Synonyms: | Phe-Gly hydrate;Phe-glycrystalline;L-Phe-Gly-OH;2-[(2-amino-3-phenylpropanoyl)amino]acetic acid;2-[(2-amino-3-phenyl-propanoyl)amino]acetic acid;2-[(2-azanyl-3-phenyl-propanoyl)amino]ethanoic acid;L-PHENYLALANYLGLYCINE;Phe-Gly hydrate >=98.0% (dried material) | | CAS: | 721-90-4 | | MF: | C11H14N2O3 | | MW: | 222.24 | | EINECS: | 222-027-9 | | Product Categories: | | | Mol File: | 721-90-4.mol |  |
| | H-Phe-Gly-OH Chemical Properties |
| Melting point | ~260 °C (dec.) | | Boiling point | 512.5±50.0 °C(Predicted) | | density | 1.259±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | solubility | Methanol (Slightly), Water (Sparingly, Sonicated) | | form | Solid | | pka | 3.13±0.10(Predicted) | | color | White to Off-White | | Optical Rotation | [α]20/D +103±3°, c = 1% in H2O | | BRN | 2218143 | | Stability: | Hygroscopic | | Major Application | peptide synthesis | | InChI | 1S/C11H14N2O3.H2O/c12-9(11(16)13-7-10(14)15)6-8-4-2-1-3-5-8;/h1-5,9H,6-7,12H2,(H,13,16)(H,14,15);1H2/t9-;/m0./s1 | | InChIKey | QNLAQUFDXQTNOW-FVGYRXGTSA-N | | SMILES | O.N[C@@H](Cc1ccccc1)C(=O)NCC(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | F | 3-10 | | Storage Class | 11 - Combustible Solids |
| | H-Phe-Gly-OH Usage And Synthesis |
| Chemical Properties | White product | | Uses | Phenylalanylglycine can be used to mask unpleasant taste impressions. | | Definition | ChEBI: A dipeptide formed from L-phenylalanine and glycine residues. |
| | H-Phe-Gly-OH Preparation Products And Raw materials |
|