|
|
| | 3-Nitrostyrene Basic information |
| | 3-Nitrostyrene Chemical Properties |
| Melting point | -5 °C (lit.) | | Boiling point | 81-83°C 1mm | | density | 1.07 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.584(lit.) | | Fp | 225 °F | | storage temp. | 2-8°C | | form | Powder or Needles | | color | White to off-white | | BRN | 2042423 | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | 1S/C8H7NO2/c1-2-7-4-3-5-8(6-7)9(10)11/h2-6H,1H2 | | InChIKey | SYZVQXIUVGKCBJ-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cccc(C=C)c1 | | CAS DataBase Reference | 586-39-0(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Nitrostyrene(586-39-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25 | | RIDADR | 2810 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29042090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Nitrostyrene Usage And Synthesis |
| Chemical Properties | liquid |
| | 3-Nitrostyrene Preparation Products And Raw materials |
|