| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
7-Hydroxy-4-methyl-8-nitrocoumarin manufacturers
|
| | 7-Hydroxy-4-methyl-8-nitrocoumarin Basic information |
| | 7-Hydroxy-4-methyl-8-nitrocoumarin Chemical Properties |
| Melting point | 254-259 °C (lit.) | | solubility | DMF: 30 mg/ml; DMF:PBS (pH 7.2) (1:2): 0.33 mg/ml; DMSO: 10 mg/ml | | form | A crystalline solid | | color | Light yellow to light brown | | BRN | 225171 | | InChI | InChI=1S/C10H7NO5/c1-5-4-8(13)16-10-6(5)2-3-7(12)9(10)11(14)15/h2-4,12H,1H3 | | InChIKey | BGUBUSIGKOWDPO-UHFFFAOYSA-N | | SMILES | C1(=O)OC2=C([N+]([O-])=O)C(O)=CC=C2C(C)=C1 |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-43-36/37/38 | | Safety Statements | 36/37-36-26 | | WGK Germany | 3 | | HS Code | 2932209090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| | 7-Hydroxy-4-methyl-8-nitrocoumarin Usage And Synthesis |
| Uses | 7-Hydroxy-4-methyl-8-nitrocoumarin is a coumarin derivative[1]. | | References | [1] Fadia Al-Haj Hussien, et al. Synthesis and Nitration of 7-Hydroxy-4-Methyl Coumarin via Pechmann Condensation Using Eco-Friendly Medias. International Letters of Chemistry, Physics and Astronomy. 2016, Vol. 69, pp 66-73. |
| | 7-Hydroxy-4-methyl-8-nitrocoumarin Preparation Products And Raw materials |
|