RESORUFIN PENTYL ETHER manufacturers
|
| | RESORUFIN PENTYL ETHER Basic information |
| Product Name: | RESORUFIN PENTYL ETHER | | Synonyms: | 7-PENTOXYRESORUFIN;7-PENTYLOXY-3H-PHENOXAZIN-3-ONE;7-PENTYLOXY-3-PHENOXAZONE;RESORUFIN PENTYL ETHER;O(7)-PENTYLRESORUFIN;O(7)-PENTYLRESORUFIN, FOR FLUORESCENCE;O(7)-PENTYLRESORUFIN FOR FLUORESCENCE 98+%;3H-Phenoxazin-3-one, 7-(pentyloxy)- | | CAS: | 87687-03-4 | | MF: | C17H17NO3 | | MW: | 283.32 | | EINECS: | | | Product Categories: | Fluorescent Labels & Indicators | | Mol File: | 87687-03-4.mol |  |
| | RESORUFIN PENTYL ETHER Chemical Properties |
| Melting point | 151-153°C | | Boiling point | 423.6±45.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | acetonitrile: 0.25 mg/mL, clear, brown-orange | | pka | 1.44±0.20(Predicted) | | form | Solid | | color | Orange to Dark Red | | BRN | 8394939 | | InChI | 1S/C17H17NO3/c1-2-3-4-9-20-13-6-8-15-17(11-13)21-16-10-12(19)5-7-14(16)18-15/h5-8,10-11H,2-4,9H2,1H3 | | InChIKey | ZPSOKQFFOYYPKC-UHFFFAOYSA-N | | SMILES | CCCCCOc1ccc2N=C3C=CC(=O)C=C3Oc2c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-23 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | RESORUFIN PENTYL ETHER Usage And Synthesis |
| Chemical Properties | Red Solid | | Uses | Fluorimetric substrate. Dealkylation of pentoxyresorufin: A rapid sensitive assay for measuring induction of cytochrome(s) P-450. | | Uses | Resorufin pentyl ether has been used as a substrate to study the effects of Kaempferia parviflora extract on mouse hepatic cytochrome P450 enzymes. | | Uses | A fluorescent indicator of Cytochrome P 450 activity. | | General Description | Resorufin pentyl ether is an analog of resazurin. Resorufin is a redox probe which is colorless and non-fluorescent in its reduced state. On oxidation, it fluoresces red. Resorufin is used widely as an indicator in microbiological media. It can be used to differentiate between actively metabolizing cells and inactive or dead cells. | | Biochem/physiol Actions | Fluorimetric substrate for cytochrome P450 linked enzymes, CYP2B and CYP2B4. |
| | RESORUFIN PENTYL ETHER Preparation Products And Raw materials |
|