| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
3-Phenoxazone 7-[beta-D-glucuronide] sodium salt manufacturers
|
| | 3-Phenoxazone 7-[beta-D-glucuronide] sodium salt Basic information |
| Product Name: | 3-Phenoxazone 7-[beta-D-glucuronide] sodium salt | | Synonyms: | RESORUFIN-B-D-GLUCURONIDE SODIUM SALT;RESORUFIN BETA-D-GLUCURONIDE;RESORUFIN BETA-D-GLUCURONIDE SODIUM SALT;3-phenoxazone 7-(β-d-glucuronide);resorufin β-d-glucuronide sodium salt;3-Oxo-3H-phenoxazin-7-yl beta-D-glucopyranosiduronic acid monosodium salt;resorufin B-D-glucuronide sodium;3-Phenoxazone 7-[ beta-D -glucuronide] | | CAS: | 125440-91-7 | | MF: | C18H15NO9.Na | | MW: | 412.3 | | EINECS: | 620-719-9 | | Product Categories: | | | Mol File: | 125440-91-7.mol | ![3-Phenoxazone 7-[beta-D-glucuronide] sodium salt Structure](CAS/GIF/125440-91-7.gif) |
| | 3-Phenoxazone 7-[beta-D-glucuronide] sodium salt Chemical Properties |
| storage temp. | -20°C | | solubility | water: 0.5 mg/mL, clear to slightly hazy, orange | | form | powder | | Water Solubility | water: 0.5mg/mL, clear to slightly hazy, orange | | InChI | 1S/C18H15NO9.Na.H/c20-7-1-3-9-11(5-7)27-12-6-8(2-4-10(12)19-9)26-18-15(23)13(21)14(22)16(28-18)17(24)25;;/h1-6,13-16,18,21-23H,(H,24,25);; | | InChIKey | AESIKFVBGSSFKP-UHFFFAOYSA-N | | SMILES | [Na].OC1C(OC(C(O)C1O)C(O)=O)Oc2ccc3N=C4C=CC(=O)C=C4Oc3c2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Phenoxazone 7-[beta-D-glucuronide] sodium salt Usage And Synthesis |
| Uses | Resorufin beta-D-Glucuronide Sodium Salt can be used for analytical reagent use and analytical/biological study of teaching single-cell digital analysis using droplet-based microfluidics. | | Uses | Resorufin β-D-glucuronide sodium salt has been used for testing enzymatic activities. | | Biochem/physiol Actions | Resorufin β-D-glucuronide serves as a substrate for β-glucuronidase enzyme. It is considered as an internal hydrolysis indicator for enzyme action. Resorufin β-D-glucuronide possesses a high extinction coefficient. |
| | 3-Phenoxazone 7-[beta-D-glucuronide] sodium salt Preparation Products And Raw materials |
|