- Norwogonin
-
- $56.00
-
2026-07-15
- CAS:4443-09-8
- Purity: 99.03%
- Supply Ability: 10g
|
| | 5,7,8-Trihydroxyflavone Basic information |
| Product Name: | 5,7,8-Trihydroxyflavone | | Synonyms: | 2-phenyl-5,7,8-trihydroxy-4h-1-benzopyran-4-on;2-phenyl-5,7,8-trihydroxy-4h-1-benzopyran-4-one;5,7,8-trihydroxy-flavon;TRIHYDROXYFLAVONE, 5,7,8-;TRIHYDROXYFLAVONE, 5,7,8-(RG);5,7,8-HYDROXYFLAVONE;4H-1-Benzopyran-4-one, 5,7,8-trihydroxy-2-phenyl-;Dimethylhanxanthin | | CAS: | 4443-09-8 | | MF: | C15H10O5 | | MW: | 270.24 | | EINECS: | | | Product Categories: | Tri-substituted Flavones | | Mol File: | 4443-09-8.mol |  |
| | 5,7,8-Trihydroxyflavone Chemical Properties |
| Melting point | 227-228 °C | | Boiling point | 528.4±50.0 °C(Predicted) | | density | 1.548±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder | | pka | 6.66±0.40(Predicted) | | color | Yellow | | InChI | InChI=1S/C15H10O5/c16-9-6-11(18)14(19)15-13(9)10(17)7-12(20-15)8-4-2-1-3-5-8/h1-7,16,18-19H | | InChIKey | ZFKKRRMUPBBYRS-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)OC2=C(O)C(O)=CC(O)=C2C(=O)C=1 | | LogP | 1.970 (est) |
| | 5,7,8-Trihydroxyflavone Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from the tuberous root of Scutellaria baicalensis Georgi. | | Uses | Norwogonin, isolated from Scutellaria baicalensis Georgi, possesses antiviral activity against Enterovirus 71 (EV71) with an IC50 of 31.83 μg/ml[1] | | Definition | ChEBI: A trihydroxyflavone with the hydroxy groups at positions C-5, -7 and -8. | | target | VHR | | References | [1] Choi HJ, et al. Inhibitory Effects of Norwogonin, Oroxylin A, and Mosloflavone on Enterovirus 71. Biomol Ther (Seoul). 2016 Sep 1;24(5):552-8. DOI:10.4062/biomolther.2015.200 |
| | 5,7,8-Trihydroxyflavone Preparation Products And Raw materials |
|