- Gardenin A
-
- $68.00
-
2026-07-27
- CAS:21187-73-5
- Purity: 99.98%
- Supply Ability: 10g
|
| | 3',4',5',6,7,8-Hexamethoxy-5-hydroxyflavone Basic information |
| Product Name: | 3',4',5',6,7,8-Hexamethoxy-5-hydroxyflavone | | Synonyms: | G LUCIDA GUM;5-HYDROXY-6,7,8,3',4',5'-HEXAMETHOXYFLAVONE;GANGLIOTRIOSYL CERAMIDE;5-Hydroxy-3',4',5',6,7,8-hexamethoxyflavone;5-hydroxy-6,7,8-trimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one;5-hydroxy-6,7,8-trimethoxy-2-(3,4,5-trimethoxyphenyl)chromone;GARDENIN;4H-1-Benzopyran-4-one, 5-hydroxy-6,7,8-trimethoxy-2-(3,4,5-trimethoxyphenyl)- | | CAS: | 21187-73-5 | | MF: | C21H22O9 | | MW: | 418.39 | | EINECS: | | | Product Categories: | Hepta-substituted Flavones | | Mol File: | 21187-73-5.mol |  |
| | 3',4',5',6,7,8-Hexamethoxy-5-hydroxyflavone Chemical Properties |
| Melting point | 162-163°C | | Boiling point | 624.2±55.0 °C(Predicted) | | density | 1.300±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | Solid | | pka | 6.80±0.40(Predicted) | | color | Off-white to light yellow | | InChI | 1S/C21H22O9/c1-24-13-7-10(8-14(25-2)17(13)26-3)12-9-11(22)15-16(23)19(27-4)21(29-6)20(28-5)18(15)30-12/h7-9,23H,1-6H3 | | InChIKey | MQBFFYQCZCKSBX-UHFFFAOYSA-N | | SMILES | [o]1c2c([c](cc1c3cc(c(c(c3)OC)OC)OC)=O)c(c(c(c2OC)OC)OC)O | | LogP | 1.800 (est) |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3',4',5',6,7,8-Hexamethoxy-5-hydroxyflavone Usage And Synthesis |
| Uses | 3'',4'',5'',6,7,8-Hexamethoxy-5-hydroxyflavone is a flavonoid and a secondary metabolite in the methanolic extract of Gardenia resinifera and Gardenia latifolia. | | in vivo | Gardenin A (0.1-25 mg/kg; p.o.; single dose) has neuropharmacological, including sedative, anxiolytic, antidepressant, and anticonvulsant actions in mice[2].
Gardenin A (1-10 mg/kg; p.o.; single dose) does not affect locomotor coordination in mice and delayed the onset of convulsions[2].
| Animal Model: | Male Balb/c mice (24-32 g)[2] | | Dosage: | 1 mg/kg, 10 mg/kg, 25 mg/kg | | Administration: | Oral gavage; single dose | | Result: | Showed sedative effects at a dose of 25 mg/kg, which increased the duration of sleep but did not alter sleep onset. |
|
| | 3',4',5',6,7,8-Hexamethoxy-5-hydroxyflavone Preparation Products And Raw materials |
|